C16H31N3O3 — CID 119767246
N-butyl-1-[[2-(2-methoxyethylamino)acetyl]amino]cyclohexane-1-carboxamide (PubChem CID 119767246) has the molecular formula C16H31N3O3 and a molecular weight of 313.44 g/mol. Its IUPAC name is N-butyl-1-[[2-(2-methoxyethylamino)acetyl]amino]cyclohexane-1-carboxamide.
| Compound Name | N-butyl-1-[[2-(2-methoxyethylamino)acetyl]amino]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 119767246 |
| Molecular Formula | C16H31N3O3 |
| Molecular Weight | 313.44 g/mol |
| Exact Mass | 313.24 |
| IUPAC Name | N-butyl-1-[[2-(2-methoxyethylamino)acetyl]amino]cyclohexane-1-carboxamide |
| SMILES | CCCCNC(=O)C1(NC(=O)CNCCOC)CCCCC1 |
| InChI | InChI=1S/C16H31N3O3/c1-3-4-10-18-15(21)16(8-6-5-7-9-16)19-14(20)13-17-11-12-22-2/h17H,3-13H2,1-2H3,(H,18,21)(H,19,20) |
| InChIKey | QGMXQGAVAZXSDR-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.44 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|