C19H29ClN2O3 — CID 119768693
7-amino-1-[2-(2,3-dihydro-1,4-benzodioxin-5-yl)pyrrolidin-1-yl]heptan-1-one;hydrochloride (PubChem CID 119768693) has the molecular formula C19H29ClN2O3 and a molecular weight of 368.91 g/mol. Its IUPAC name is 7-amino-1-[2-(2,3-dihydro-1,4-benzodioxin-5-yl)pyrrolidin-1-yl]heptan-1-one;hydrochloride.
| Compound Name | 7-amino-1-[2-(2,3-dihydro-1,4-benzodioxin-5-yl)pyrrolidin-1-yl]heptan-1-one;hydrochloride |
|---|---|
| PubChem CID | 119768693 |
| Molecular Formula | C19H29ClN2O3 |
| Molecular Weight | 368.91 g/mol |
| Exact Mass | 368.19 |
| IUPAC Name | 7-amino-1-[2-(2,3-dihydro-1,4-benzodioxin-5-yl)pyrrolidin-1-yl]heptan-1-one;hydrochloride |
| SMILES | Cl.NCCCCCCC(=O)N1CCCC1c1cccc2c1OCCO2 |
| InChI | InChI=1S/C19H28N2O3.ClH/c20-11-4-2-1-3-10-18(22)21-12-6-8-16(21)15-7-5-9-17-19(15)24-14-13-23-17;/h5,7,9,16H,1-4,6,8,10-14,20H2;1H |
| InChIKey | PGSMELLGLZWTJM-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.91 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|