C20H25ClN2O4S — CID 119769505
3-amino-N-[4-(4-methylsulfonylphenoxy)phenyl]cyclohexane-1-carboxamide;hydrochloride (PubChem CID 119769505) has the molecular formula C20H25ClN2O4S and a molecular weight of 424.95 g/mol. Its IUPAC name is 3-amino-N-[4-(4-methylsulfonylphenoxy)phenyl]cyclohexane-1-carboxamide;hydrochloride.
| Compound Name | 3-amino-N-[4-(4-methylsulfonylphenoxy)phenyl]cyclohexane-1-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119769505 |
| Molecular Formula | C20H25ClN2O4S |
| Molecular Weight | 424.95 g/mol |
| Exact Mass | 424.12 |
| IUPAC Name | 3-amino-N-[4-(4-methylsulfonylphenoxy)phenyl]cyclohexane-1-carboxamide;hydrochloride |
| SMILES | CS(=O)(=O)c1ccc(Oc2ccc(NC(=O)C3CCCC(N)C3)cc2)cc1.Cl |
| InChI | InChI=1S/C20H24N2O4S.ClH/c1-27(24,25)19-11-9-18(10-12-19)26-17-7-5-16(6-8-17)22-20(23)14-3-2-4-15(21)13-14;/h5-12,14-15H,2-4,13,21H2,1H3,(H,22,23);1H |
| InChIKey | AELVVBMMWUHIET-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.95 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |