C14H23N5O — CID 119770730
3-amino-N-(2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)cyclohexane-1-carboxamide (PubChem CID 119770730) has the molecular formula C14H23N5O and a molecular weight of 277.37 g/mol. Its IUPAC name is 3-amino-N-(2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)cyclohexane-1-carboxamide.
| Compound Name | 3-amino-N-(2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 119770730 |
| Molecular Formula | C14H23N5O |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.19 |
| IUPAC Name | 3-amino-N-(2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)cyclohexane-1-carboxamide |
| SMILES | Cc1nc2n(n1)CC(NC(=O)C1CCCC(N)C1)CC2 |
| InChI | InChI=1S/C14H23N5O/c1-9-16-13-6-5-12(8-19(13)18-9)17-14(20)10-3-2-4-11(15)7-10/h10-12H,2-8,15H2,1H3,(H,17,20) |
| InChIKey | UTMQVAVUGPXNIT-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |