C15H22O4 — CID 11977176
methyl (1R,2R,4S,6S,7S,10R,11S)-10,11-dihydroxy-1,4-dimethyltricyclo[5.2.2.02,6]undec-8-ene-4-carboxylate (PubChem CID 11977176) has the molecular formula C15H22O4 and a molecular weight of 266.34 g/mol. Its IUPAC name is methyl (1R,2R,4S,6S,7S,10R,11S)-10,11-dihydroxy-1,4-dimethyltricyclo[5.2.2.02,6]undec-8-ene-4-carboxylate.
| Compound Name | methyl (1R,2R,4S,6S,7S,10R,11S)-10,11-dihydroxy-1,4-dimethyltricyclo[5.2.2.02,6]undec-8-ene-4-carboxylate |
|---|---|
| PubChem CID | 11977176 |
| Molecular Formula | C15H22O4 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | methyl (1R,2R,4S,6S,7S,10R,11S)-10,11-dihydroxy-1,4-dimethyltricyclo[5.2.2.02,6]undec-8-ene-4-carboxylate |
| SMILES | COC(=O)[C@@]1(C)C[C@@H]2[C@@H]3C=C[C@](C)([C@@H]2C1)[C@@H](O)[C@H]3O |
| InChI | InChI=1S/C15H22O4/c1-14(13(18)19-3)6-9-8-4-5-15(2,10(9)7-14)12(17)11(8)16/h4-5,8-12,16-17H,6-7H2,1-3H3/t8-,9+,10+,11-,12-,14-,15+/m0/s1 |
| InChIKey | BMFCXSRBEYIIMS-IRKGCBOHSA-N |
| XLogP | 1.12 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|