C19H24ClN3O3 — CID 119771763
N-[1-(3-aminobenzoyl)piperidin-4-yl]-2,5-dimethylfuran-3-carboxamide;hydrochloride (PubChem CID 119771763) has the molecular formula C19H24ClN3O3 and a molecular weight of 377.87 g/mol. Its IUPAC name is N-[1-(3-aminobenzoyl)piperidin-4-yl]-2,5-dimethylfuran-3-carboxamide;hydrochloride.
| Compound Name | N-[1-(3-aminobenzoyl)piperidin-4-yl]-2,5-dimethylfuran-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119771763 |
| Molecular Formula | C19H24ClN3O3 |
| Molecular Weight | 377.87 g/mol |
| Exact Mass | 377.15 |
| IUPAC Name | N-[1-(3-aminobenzoyl)piperidin-4-yl]-2,5-dimethylfuran-3-carboxamide;hydrochloride |
| SMILES | Cc1cc(C(=O)NC2CCN(C(=O)c3cccc(N)c3)CC2)c(C)o1.Cl |
| InChI | InChI=1S/C19H23N3O3.ClH/c1-12-10-17(13(2)25-12)18(23)21-16-6-8-22(9-7-16)19(24)14-4-3-5-15(20)11-14;/h3-5,10-11,16H,6-9,20H2,1-2H3,(H,21,23);1H |
| InChIKey | AWYGVVVJMOUQTM-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 88.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.87 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|