C17H23N2O+ — CID 11977229
(5S,7R)-1-benzyl-5,7-dimethyl-3-aza-1-azoniatricyclo[3.3.1.13,7]decan-6-one (PubChem CID 11977229) has the molecular formula C17H23N2O+ and a molecular weight of 271.38 g/mol. Its IUPAC name is (5S,7R)-1-benzyl-5,7-dimethyl-3-aza-1-azoniatricyclo[3.3.1.13,7]decan-6-one.
| Compound Name | (5S,7R)-1-benzyl-5,7-dimethyl-3-aza-1-azoniatricyclo[3.3.1.13,7]decan-6-one |
|---|---|
| PubChem CID | 11977229 |
| Molecular Formula | C17H23N2O+ |
| Molecular Weight | 271.38 g/mol |
| Exact Mass | 271.18 |
| IUPAC Name | (5S,7R)-1-benzyl-5,7-dimethyl-3-aza-1-azoniatricyclo[3.3.1.13,7]decan-6-one |
| SMILES | C[C@]12CN3C[C@](C)(C[N+](Cc4ccccc4)(C3)C1)C2=O |
| InChI | InChI=1S/C17H23N2O/c1-16-9-18-10-17(2,15(16)20)12-19(11-16,13-18)8-14-6-4-3-5-7-14/h3-7H,8-13H2,1-2H3/q+1/t16-,17+,19? |
| InChIKey | WMIJZJNIZVNOGK-JJTKIYQPSA-N |
| XLogP | 1.89 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.38 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|