C17H27ClN2O — CID 119772417
2-(cyclopropylmethylamino)-N-(2-methyl-4-phenylbutan-2-yl)acetamide;hydrochloride (PubChem CID 119772417) has the molecular formula C17H27ClN2O and a molecular weight of 310.87 g/mol. Its IUPAC name is 2-(cyclopropylmethylamino)-N-(2-methyl-4-phenylbutan-2-yl)acetamide;hydrochloride.
| Compound Name | 2-(cyclopropylmethylamino)-N-(2-methyl-4-phenylbutan-2-yl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 119772417 |
| Molecular Formula | C17H27ClN2O |
| Molecular Weight | 310.87 g/mol |
| Exact Mass | 310.18 |
| IUPAC Name | 2-(cyclopropylmethylamino)-N-(2-methyl-4-phenylbutan-2-yl)acetamide;hydrochloride |
| SMILES | CC(C)(CCc1ccccc1)NC(=O)CNCC1CC1.Cl |
| InChI | InChI=1S/C17H26N2O.ClH/c1-17(2,11-10-14-6-4-3-5-7-14)19-16(20)13-18-12-15-8-9-15;/h3-7,15,18H,8-13H2,1-2H3,(H,19,20);1H |
| InChIKey | IOLJKAVVFSIUQC-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.87 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |