About 1-[3-[(2E,4E)-hexa-2,4-dienoxy]prop-1-ynyl]-4-(trifluoromethyl)benzene
1-[3-[(2E,4E)-hexa-2,4-dienoxy]prop-1-ynyl]-4-(trifluoromethyl)benzene (PubChem CID 11977314) has the molecular formula C16H15F3O
and a molecular weight of 280.29 g/mol. Its IUPAC name is 1-[3-[(2E,4E)-hexa-2,4-dienoxy]prop-1-ynyl]-4-(trifluoromethyl)benzene.
Molecular Properties
| Compound Name | 1-[3-[(2E,4E)-hexa-2,4-dienoxy]prop-1-ynyl]-4-(trifluoromethyl)benzene |
| PubChem CID | 11977314 |
| Molecular Formula | C16H15F3O |
| Molecular Weight | 280.29 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | 1-[3-[(2E,4E)-hexa-2,4-dienoxy]prop-1-ynyl]-4-(trifluoromethyl)benzene |
| SMILES | C/C=C/C=C/COCC#Cc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C16H15F3O/c1-2-3-4-5-12-20-13-6-7-14-8-10-15(11-9-14)16(17,18)19/h2-5,8-11H,12-13H2,1H3/b3-2+,5-4+ |
| InChIKey | BLQDNMXDMCOREO-MQQKCMAXSA-N |
| XLogP | 4.21 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.29 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-[3-[(2E,4E)-hexa-2,4-dienoxy]prop-1-ynyl]-4-(trifluoromethyl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-[(2E,4E)-hexa-2,4-dienoxy]prop-1-ynyl]-4-(trifluoromethyl)benzene?
The IUPAC name of 1-[3-[(2E,4E)-hexa-2,4-dienoxy]prop-1-ynyl]-4-(trifluoromethyl)benzene (CID 11977314) is 1-[3-[(2E,4E)-hexa-2,4-dienoxy]prop-1-ynyl]-4-(trifluoromethyl)benzene.
What is the SMILES notation for 1-[3-[(2E,4E)-hexa-2,4-dienoxy]prop-1-ynyl]-4-(trifluoromethyl)benzene?
The canonical SMILES for 1-[3-[(2E,4E)-hexa-2,4-dienoxy]prop-1-ynyl]-4-(trifluoromethyl)benzene is C/C=C/C=C/COCC#Cc1ccc(C(F)(F)F)cc1.
What is the InChIKey of 1-[3-[(2E,4E)-hexa-2,4-dienoxy]prop-1-ynyl]-4-(trifluoromethyl)benzene?
The InChIKey is BLQDNMXDMCOREO-MQQKCMAXSA-N. The full InChI is InChI=1S/C16H15F3O/c1-2-3-4-5-12-20-13-6-7-14-8-10-15(11-9-14)16(17,18)19/h2-5,8-11H,12-13H2,1H3/b3-2+,5-4+.
What are the key properties of 1-[3-[(2E,4E)-hexa-2,4-dienoxy]prop-1-ynyl]-4-(trifluoromethyl)benzene?
1-[3-[(2E,4E)-hexa-2,4-dienoxy]prop-1-ynyl]-4-(trifluoromethyl)benzene has a molecular weight of 280.29 g/mol, XLogP of 4.21, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-[(2E,4E)-hexa-2,4-dienoxy]prop-1-ynyl]-4-(trifluoromethyl)benzene is sourced from PubChem (CID 11977314), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).