C24H44O2Si — CID 11977341
1-[(1S,2S,3R,4aS,8aR)-1-ethenyl-3-[tri(propan-2-yl)silyloxymethyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]ethanone (PubChem CID 11977341) has the molecular formula C24H44O2Si and a molecular weight of 392.70 g/mol. Its IUPAC name is 1-[(1S,2S,3R,4aS,8aR)-1-ethenyl-3-[tri(propan-2-yl)silyloxymethyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]ethanone.
| Compound Name | 1-[(1S,2S,3R,4aS,8aR)-1-ethenyl-3-[tri(propan-2-yl)silyloxymethyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]ethanone |
|---|---|
| PubChem CID | 11977341 |
| Molecular Formula | C24H44O2Si |
| Molecular Weight | 392.70 g/mol |
| Exact Mass | 392.31 |
| IUPAC Name | 1-[(1S,2S,3R,4aS,8aR)-1-ethenyl-3-[tri(propan-2-yl)silyloxymethyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]ethanone |
| SMILES | C=C[C@H]1[C@@H]2CCCC[C@H]2C[C@@H](CO[Si](C(C)C)(C(C)C)C(C)C)[C@H]1C(C)=O |
| InChI | InChI=1S/C24H44O2Si/c1-9-22-23-13-11-10-12-20(23)14-21(24(22)19(8)25)15-26-27(16(2)3,17(4)5)18(6)7/h9,16-18,20-24H,1,10-15H2,2-8H3/t20-,21-,22-,23+,24+/m0/s1 |
| InChIKey | HEVYZOZANIBCSS-ZROJVYTPSA-N |
| XLogP | 7.01 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.70 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|