About N-(4-bromo-2,3-dihydro-1H-inden-1-yl)-4-methoxypiperidine-4-carboxamide;hydrochloride
N-(4-bromo-2,3-dihydro-1H-inden-1-yl)-4-methoxypiperidine-4-carboxamide;hydrochloride (PubChem CID 119773537) has the molecular formula C16H22BrClN2O2
and a molecular weight of 389.72 g/mol. Its IUPAC name is N-(4-bromo-2,3-dihydro-1H-inden-1-yl)-4-methoxypiperidine-4-carboxamide;hydrochloride.
Molecular Properties
| Compound Name | N-(4-bromo-2,3-dihydro-1H-inden-1-yl)-4-methoxypiperidine-4-carboxamide;hydrochloride |
| PubChem CID | 119773537 |
| Molecular Formula | C16H22BrClN2O2 |
| Molecular Weight | 389.72 g/mol |
| Exact Mass | 388.06 |
| IUPAC Name | N-(4-bromo-2,3-dihydro-1H-inden-1-yl)-4-methoxypiperidine-4-carboxamide;hydrochloride |
| SMILES | COC1(C(=O)NC2CCc3c(Br)cccc32)CCNCC1.Cl |
| InChI | InChI=1S/C16H21BrN2O2.ClH/c1-21-16(7-9-18-10-8-16)15(20)19-14-6-5-11-12(14)3-2-4-13(11)17;/h2-4,14,18H,5-10H2,1H3,(H,19,20);1H |
| InChIKey | BFWLIYKWOBMFCV-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 389.72 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(4-bromo-2,3-dihydro-1H-inden-1-yl)-4-methoxypiperidine-4-carboxamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-bromo-2,3-dihydro-1H-inden-1-yl)-4-methoxypiperidine-4-carboxamide;hydrochloride?
The IUPAC name of N-(4-bromo-2,3-dihydro-1H-inden-1-yl)-4-methoxypiperidine-4-carboxamide;hydrochloride (CID 119773537) is N-(4-bromo-2,3-dihydro-1H-inden-1-yl)-4-methoxypiperidine-4-carboxamide;hydrochloride.
What is the SMILES notation for N-(4-bromo-2,3-dihydro-1H-inden-1-yl)-4-methoxypiperidine-4-carboxamide;hydrochloride?
The canonical SMILES for N-(4-bromo-2,3-dihydro-1H-inden-1-yl)-4-methoxypiperidine-4-carboxamide;hydrochloride is COC1(C(=O)NC2CCc3c(Br)cccc32)CCNCC1.Cl.
What is the InChIKey of N-(4-bromo-2,3-dihydro-1H-inden-1-yl)-4-methoxypiperidine-4-carboxamide;hydrochloride?
The InChIKey is BFWLIYKWOBMFCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21BrN2O2.ClH/c1-21-16(7-9-18-10-8-16)15(20)19-14-6-5-11-12(14)3-2-4-13(11)17;/h2-4,14,18H,5-10H2,1H3,(H,19,20);1H.
What are the key properties of N-(4-bromo-2,3-dihydro-1H-inden-1-yl)-4-methoxypiperidine-4-carboxamide;hydrochloride?
N-(4-bromo-2,3-dihydro-1H-inden-1-yl)-4-methoxypiperidine-4-carboxamide;hydrochloride has a molecular weight of 389.72 g/mol, XLogP of 2.74, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-bromo-2,3-dihydro-1H-inden-1-yl)-4-methoxypiperidine-4-carboxamide;hydrochloride is sourced from PubChem (CID 119773537), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).