C37H48O8Si — CID 11977357
[(E)-3-[tert-butyl(dimethyl)silyl]oxy-4-phenylmethoxybut-2-enyl] (2R,3R,4R,5R)-5-methoxy-3,4-bis(phenylmethoxy)oxolane-2-carboxylate (PubChem CID 11977357) has the molecular formula C37H48O8Si and a molecular weight of 648.87 g/mol. Its IUPAC name is [(E)-3-[tert-butyl(dimethyl)silyl]oxy-4-phenylmethoxybut-2-enyl] (2R,3R,4R,5R)-5-methoxy-3,4-bis(phenylmethoxy)oxolane-2-carboxylate.
| Compound Name | [(E)-3-[tert-butyl(dimethyl)silyl]oxy-4-phenylmethoxybut-2-enyl] (2R,3R,4R,5R)-5-methoxy-3,4-bis(phenylmethoxy)oxolane-2-carboxylate |
|---|---|
| PubChem CID | 11977357 |
| Molecular Formula | C37H48O8Si |
| Molecular Weight | 648.87 g/mol |
| Exact Mass | 648.31 |
| IUPAC Name | [(E)-3-[tert-butyl(dimethyl)silyl]oxy-4-phenylmethoxybut-2-enyl] (2R,3R,4R,5R)-5-methoxy-3,4-bis(phenylmethoxy)oxolane-2-carboxylate |
| SMILES | CO[C@@H]1O[C@@H](C(=O)OC/C=C(\COCc2ccccc2)O[Si](C)(C)C(C)(C)C)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C37H48O8Si/c1-37(2,3)46(5,6)45-31(27-40-24-28-16-10-7-11-17-28)22-23-41-35(38)33-32(42-25-29-18-12-8-13-19-29)34(36(39-4)44-33)43-26-30-20-14-9-15-21-30/h7-22,32-34,36H,23-27H2,1-6H3/b31-22+/t32-,33+,34+,36+/m0/s1 |
| InChIKey | FMDHHWQIOPHDEX-FNCXJCSQSA-N |
| XLogP | 7.19 |
| TPSA | 81.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.87 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|