C22H31ClN2O2 — CID 119773875
N-cyclopentyl-N-[(2-methoxynaphthalen-1-yl)methyl]-4-(methylamino)butanamide;hydrochloride (PubChem CID 119773875) has the molecular formula C22H31ClN2O2 and a molecular weight of 390.96 g/mol. Its IUPAC name is N-cyclopentyl-N-[(2-methoxynaphthalen-1-yl)methyl]-4-(methylamino)butanamide;hydrochloride.
| Compound Name | N-cyclopentyl-N-[(2-methoxynaphthalen-1-yl)methyl]-4-(methylamino)butanamide;hydrochloride |
|---|---|
| PubChem CID | 119773875 |
| Molecular Formula | C22H31ClN2O2 |
| Molecular Weight | 390.96 g/mol |
| Exact Mass | 390.21 |
| IUPAC Name | N-cyclopentyl-N-[(2-methoxynaphthalen-1-yl)methyl]-4-(methylamino)butanamide;hydrochloride |
| SMILES | CNCCCC(=O)N(Cc1c(OC)ccc2ccccc12)C1CCCC1.Cl |
| InChI | InChI=1S/C22H30N2O2.ClH/c1-23-15-7-12-22(25)24(18-9-4-5-10-18)16-20-19-11-6-3-8-17(19)13-14-21(20)26-2;/h3,6,8,11,13-14,18,23H,4-5,7,9-10,12,15-16H2,1-2H3;1H |
| InChIKey | BYLINHVXFVLYPN-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.96 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|