C13H23ClN2OS — CID 119774183
(3-amino-2-bicyclo[2.2.1]heptanyl)-(2-methylthiomorpholin-4-yl)methanone;hydrochloride (PubChem CID 119774183) has the molecular formula C13H23ClN2OS and a molecular weight of 290.86 g/mol. Its IUPAC name is (3-amino-2-bicyclo[2.2.1]heptanyl)-(2-methylthiomorpholin-4-yl)methanone;hydrochloride.
| Compound Name | (3-amino-2-bicyclo[2.2.1]heptanyl)-(2-methylthiomorpholin-4-yl)methanone;hydrochloride |
|---|---|
| PubChem CID | 119774183 |
| Molecular Formula | C13H23ClN2OS |
| Molecular Weight | 290.86 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | (3-amino-2-bicyclo[2.2.1]heptanyl)-(2-methylthiomorpholin-4-yl)methanone;hydrochloride |
| SMILES | CC1CN(C(=O)C2C3CCC(C3)C2N)CCS1.Cl |
| InChI | InChI=1S/C13H22N2OS.ClH/c1-8-7-15(4-5-17-8)13(16)11-9-2-3-10(6-9)12(11)14;/h8-12H,2-7,14H2,1H3;1H |
| InChIKey | RBGBXBDBPWGTHD-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.86 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |