C19H11F6NO3S — CID 11977479
2-[[5-(trifluoromethyl)-2-[(2,4,5-trifluorophenyl)methoxy]phenyl]methyl]-1,3-thiazole-4-carboxylic acid (PubChem CID 11977479) has the molecular formula C19H11F6NO3S and a molecular weight of 447.36 g/mol. Its IUPAC name is 2-[[5-(trifluoromethyl)-2-[(2,4,5-trifluorophenyl)methoxy]phenyl]methyl]-1,3-thiazole-4-carboxylic acid.
| Compound Name | 2-[[5-(trifluoromethyl)-2-[(2,4,5-trifluorophenyl)methoxy]phenyl]methyl]-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 11977479 |
| Molecular Formula | C19H11F6NO3S |
| Molecular Weight | 447.36 g/mol |
| Exact Mass | 447.04 |
| IUPAC Name | 2-[[5-(trifluoromethyl)-2-[(2,4,5-trifluorophenyl)methoxy]phenyl]methyl]-1,3-thiazole-4-carboxylic acid |
| SMILES | O=C(O)c1csc(Cc2cc(C(F)(F)F)ccc2OCc2cc(F)c(F)cc2F)n1 |
| InChI | InChI=1S/C19H11F6NO3S/c20-12-6-14(22)13(21)4-10(12)7-29-16-2-1-11(19(23,24)25)3-9(16)5-17-26-15(8-30-17)18(27)28/h1-4,6,8H,5,7H2,(H,27,28) |
| InChIKey | ITBLGTJZXBAPDB-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.36 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|