C17H26Cl2N2O2 — CID 119774901
7-amino-1-[2-(2-chlorophenyl)morpholin-4-yl]heptan-1-one;hydrochloride (PubChem CID 119774901) has the molecular formula C17H26Cl2N2O2 and a molecular weight of 361.31 g/mol. Its IUPAC name is 7-amino-1-[2-(2-chlorophenyl)morpholin-4-yl]heptan-1-one;hydrochloride.
| Compound Name | 7-amino-1-[2-(2-chlorophenyl)morpholin-4-yl]heptan-1-one;hydrochloride |
|---|---|
| PubChem CID | 119774901 |
| Molecular Formula | C17H26Cl2N2O2 |
| Molecular Weight | 361.31 g/mol |
| Exact Mass | 360.14 |
| IUPAC Name | 7-amino-1-[2-(2-chlorophenyl)morpholin-4-yl]heptan-1-one;hydrochloride |
| SMILES | Cl.NCCCCCCC(=O)N1CCOC(c2ccccc2Cl)C1 |
| InChI | InChI=1S/C17H25ClN2O2.ClH/c18-15-8-5-4-7-14(15)16-13-20(11-12-22-16)17(21)9-3-1-2-6-10-19;/h4-5,7-8,16H,1-3,6,9-13,19H2;1H |
| InChIKey | XJSWRWCCKCTTDK-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.31 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|