C15H21F3N2O2 — CID 119778089
2-amino-2-methyl-N-[2-[2-(trifluoromethyl)phenoxy]ethyl]pentanamide (PubChem CID 119778089) has the molecular formula C15H21F3N2O2 and a molecular weight of 318.34 g/mol. Its IUPAC name is 2-amino-2-methyl-N-[2-[2-(trifluoromethyl)phenoxy]ethyl]pentanamide.
| Compound Name | 2-amino-2-methyl-N-[2-[2-(trifluoromethyl)phenoxy]ethyl]pentanamide |
|---|---|
| PubChem CID | 119778089 |
| Molecular Formula | C15H21F3N2O2 |
| Molecular Weight | 318.34 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | 2-amino-2-methyl-N-[2-[2-(trifluoromethyl)phenoxy]ethyl]pentanamide |
| SMILES | CCCC(C)(N)C(=O)NCCOc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C15H21F3N2O2/c1-3-8-14(2,19)13(21)20-9-10-22-12-7-5-4-6-11(12)15(16,17)18/h4-7H,3,8-10,19H2,1-2H3,(H,20,21) |
| InChIKey | JGFXXPNHIWGDGP-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.34 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|