C22H34N2O2 — CID 119779820
3-amino-2-methyl-1-[4-(4-methylcyclohexyl)oxypiperidin-1-yl]-3-phenylpropan-1-one (PubChem CID 119779820) has the molecular formula C22H34N2O2 and a molecular weight of 358.53 g/mol. Its IUPAC name is 3-amino-2-methyl-1-[4-(4-methylcyclohexyl)oxypiperidin-1-yl]-3-phenylpropan-1-one.
| Compound Name | 3-amino-2-methyl-1-[4-(4-methylcyclohexyl)oxypiperidin-1-yl]-3-phenylpropan-1-one |
|---|---|
| PubChem CID | 119779820 |
| Molecular Formula | C22H34N2O2 |
| Molecular Weight | 358.53 g/mol |
| Exact Mass | 358.26 |
| IUPAC Name | 3-amino-2-methyl-1-[4-(4-methylcyclohexyl)oxypiperidin-1-yl]-3-phenylpropan-1-one |
| SMILES | CC1CCC(OC2CCN(C(=O)C(C)C(N)c3ccccc3)CC2)CC1 |
| InChI | InChI=1S/C22H34N2O2/c1-16-8-10-19(11-9-16)26-20-12-14-24(15-13-20)22(25)17(2)21(23)18-6-4-3-5-7-18/h3-7,16-17,19-21H,8-15,23H2,1-2H3 |
| InChIKey | GRMSKQUGKOWNQW-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.53 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |