C20H32ClN3O2 — CID 119780279
2-methyl-4-(3-piperidin-4-ylbutanoylamino)-N-propan-2-ylbenzamide;hydrochloride (PubChem CID 119780279) has the molecular formula C20H32ClN3O2 and a molecular weight of 381.95 g/mol. Its IUPAC name is 2-methyl-4-(3-piperidin-4-ylbutanoylamino)-N-propan-2-ylbenzamide;hydrochloride.
| Compound Name | 2-methyl-4-(3-piperidin-4-ylbutanoylamino)-N-propan-2-ylbenzamide;hydrochloride |
|---|---|
| PubChem CID | 119780279 |
| Molecular Formula | C20H32ClN3O2 |
| Molecular Weight | 381.95 g/mol |
| Exact Mass | 381.22 |
| IUPAC Name | 2-methyl-4-(3-piperidin-4-ylbutanoylamino)-N-propan-2-ylbenzamide;hydrochloride |
| SMILES | Cc1cc(NC(=O)CC(C)C2CCNCC2)ccc1C(=O)NC(C)C.Cl |
| InChI | InChI=1S/C20H31N3O2.ClH/c1-13(2)22-20(25)18-6-5-17(11-15(18)4)23-19(24)12-14(3)16-7-9-21-10-8-16;/h5-6,11,13-14,16,21H,7-10,12H2,1-4H3,(H,22,25)(H,23,24);1H |
| InChIKey | BOOJIRKEFGOHAT-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.95 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |