C17H29ClN2O3 — CID 119780509
N-[2-(2-tert-butylphenoxy)ethyl]-2-(2-methoxyethylamino)acetamide;hydrochloride (PubChem CID 119780509) has the molecular formula C17H29ClN2O3 and a molecular weight of 344.88 g/mol. Its IUPAC name is N-[2-(2-tert-butylphenoxy)ethyl]-2-(2-methoxyethylamino)acetamide;hydrochloride.
| Compound Name | N-[2-(2-tert-butylphenoxy)ethyl]-2-(2-methoxyethylamino)acetamide;hydrochloride |
|---|---|
| PubChem CID | 119780509 |
| Molecular Formula | C17H29ClN2O3 |
| Molecular Weight | 344.88 g/mol |
| Exact Mass | 344.19 |
| IUPAC Name | N-[2-(2-tert-butylphenoxy)ethyl]-2-(2-methoxyethylamino)acetamide;hydrochloride |
| SMILES | COCCNCC(=O)NCCOc1ccccc1C(C)(C)C.Cl |
| InChI | InChI=1S/C17H28N2O3.ClH/c1-17(2,3)14-7-5-6-8-15(14)22-12-10-19-16(20)13-18-9-11-21-4;/h5-8,18H,9-13H2,1-4H3,(H,19,20);1H |
| InChIKey | UZZMLRNTHHUCHN-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.88 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|