C19H31N3O2 — CID 119780750
7-amino-N-[3-(2,2-dimethylpropanoylamino)-4-methylphenyl]heptanamide (PubChem CID 119780750) has the molecular formula C19H31N3O2 and a molecular weight of 333.48 g/mol. Its IUPAC name is 7-amino-N-[3-(2,2-dimethylpropanoylamino)-4-methylphenyl]heptanamide.
| Compound Name | 7-amino-N-[3-(2,2-dimethylpropanoylamino)-4-methylphenyl]heptanamide |
|---|---|
| PubChem CID | 119780750 |
| Molecular Formula | C19H31N3O2 |
| Molecular Weight | 333.48 g/mol |
| Exact Mass | 333.24 |
| IUPAC Name | 7-amino-N-[3-(2,2-dimethylpropanoylamino)-4-methylphenyl]heptanamide |
| SMILES | Cc1ccc(NC(=O)CCCCCCN)cc1NC(=O)C(C)(C)C |
| InChI | InChI=1S/C19H31N3O2/c1-14-10-11-15(13-16(14)22-18(24)19(2,3)4)21-17(23)9-7-5-6-8-12-20/h10-11,13H,5-9,12,20H2,1-4H3,(H,21,23)(H,22,24) |
| InChIKey | KTUSTWRZNZPWFB-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.48 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|