C14H22BrClN2O — CID 119781005
(2S)-2-amino-N-[(4-bromo-2-methylphenyl)methyl]-4-methylpentanamide;hydrochloride (PubChem CID 119781005) has the molecular formula C14H22BrClN2O and a molecular weight of 349.70 g/mol. Its IUPAC name is (2S)-2-amino-N-[(4-bromo-2-methylphenyl)methyl]-4-methylpentanamide;hydrochloride.
| Compound Name | (2S)-2-amino-N-[(4-bromo-2-methylphenyl)methyl]-4-methylpentanamide;hydrochloride |
|---|---|
| PubChem CID | 119781005 |
| Molecular Formula | C14H22BrClN2O |
| Molecular Weight | 349.70 g/mol |
| Exact Mass | 348.06 |
| IUPAC Name | (2S)-2-amino-N-[(4-bromo-2-methylphenyl)methyl]-4-methylpentanamide;hydrochloride |
| SMILES | Cc1cc(Br)ccc1CNC(=O)[C@@H](N)CC(C)C.Cl |
| InChI | InChI=1S/C14H21BrN2O.ClH/c1-9(2)6-13(16)14(18)17-8-11-4-5-12(15)7-10(11)3;/h4-5,7,9,13H,6,8,16H2,1-3H3,(H,17,18);1H/t13-;/m0./s1 |
| InChIKey | VPCLMXBAWGVCKA-ZOWNYOTGSA-N |
| XLogP | 3.17 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.70 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |