C10H18ClF3N2O — CID 119781580
2-pyrrolidin-2-yl-N-(4,4,4-trifluorobutyl)acetamide;hydrochloride (PubChem CID 119781580) has the molecular formula C10H18ClF3N2O and a molecular weight of 274.71 g/mol. Its IUPAC name is 2-pyrrolidin-2-yl-N-(4,4,4-trifluorobutyl)acetamide;hydrochloride.
| Compound Name | 2-pyrrolidin-2-yl-N-(4,4,4-trifluorobutyl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 119781580 |
| Molecular Formula | C10H18ClF3N2O |
| Molecular Weight | 274.71 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | 2-pyrrolidin-2-yl-N-(4,4,4-trifluorobutyl)acetamide;hydrochloride |
| SMILES | Cl.O=C(CC1CCCN1)NCCCC(F)(F)F |
| InChI | InChI=1S/C10H17F3N2O.ClH/c11-10(12,13)4-2-6-15-9(16)7-8-3-1-5-14-8;/h8,14H,1-7H2,(H,15,16);1H |
| InChIKey | YYGFYUMQASUXAO-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.71 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|