C9H16ClF3N2O — CID 119781584
N-(4,4,4-trifluorobutyl)pyrrolidine-3-carboxamide;hydrochloride (PubChem CID 119781584) has the molecular formula C9H16ClF3N2O and a molecular weight of 260.69 g/mol. Its IUPAC name is N-(4,4,4-trifluorobutyl)pyrrolidine-3-carboxamide;hydrochloride.
| Compound Name | N-(4,4,4-trifluorobutyl)pyrrolidine-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119781584 |
| Molecular Formula | C9H16ClF3N2O |
| Molecular Weight | 260.69 g/mol |
| Exact Mass | 260.09 |
| IUPAC Name | N-(4,4,4-trifluorobutyl)pyrrolidine-3-carboxamide;hydrochloride |
| SMILES | Cl.O=C(NCCCC(F)(F)F)C1CCNC1 |
| InChI | InChI=1S/C9H15F3N2O.ClH/c10-9(11,12)3-1-4-14-8(15)7-2-5-13-6-7;/h7,13H,1-6H2,(H,14,15);1H |
| InChIKey | HDYZVHCVUOIMNM-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.69 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|