C12H23ClN2O2 — CID 119782231
(2S)-N-[(2-methyloxolan-2-yl)methyl]piperidine-2-carboxamide;hydrochloride (PubChem CID 119782231) has the molecular formula C12H23ClN2O2 and a molecular weight of 262.78 g/mol. Its IUPAC name is (2S)-N-[(2-methyloxolan-2-yl)methyl]piperidine-2-carboxamide;hydrochloride.
| Compound Name | (2S)-N-[(2-methyloxolan-2-yl)methyl]piperidine-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119782231 |
| Molecular Formula | C12H23ClN2O2 |
| Molecular Weight | 262.78 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | (2S)-N-[(2-methyloxolan-2-yl)methyl]piperidine-2-carboxamide;hydrochloride |
| SMILES | CC1(CNC(=O)[C@@H]2CCCCN2)CCCO1.Cl |
| InChI | InChI=1S/C12H22N2O2.ClH/c1-12(6-4-8-16-12)9-14-11(15)10-5-2-3-7-13-10;/h10,13H,2-9H2,1H3,(H,14,15);1H/t10-,12?;/m0./s1 |
| InChIKey | ONBCFCMCCDNJOE-JQQXDGTNSA-N |
| XLogP | 1.24 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.78 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |