About (3E)-1-[(3,3-dimethylpiperidin-1-yl)methyl]-3-(1H-indol-3-ylmethylidene)indol-2-one
(3E)-1-[(3,3-dimethylpiperidin-1-yl)methyl]-3-(1H-indol-3-ylmethylidene)indol-2-one (PubChem CID 11978232) has the molecular formula C25H27N3O
and a molecular weight of 385.51 g/mol. Its IUPAC name is (3E)-1-[(3,3-dimethylpiperidin-1-yl)methyl]-3-(1H-indol-3-ylmethylidene)indol-2-one.
Molecular Properties
| Compound Name | (3E)-1-[(3,3-dimethylpiperidin-1-yl)methyl]-3-(1H-indol-3-ylmethylidene)indol-2-one |
| PubChem CID | 11978232 |
| Molecular Formula | C25H27N3O |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.22 |
| IUPAC Name | (3E)-1-[(3,3-dimethylpiperidin-1-yl)methyl]-3-(1H-indol-3-ylmethylidene)indol-2-one |
| SMILES | CC1(C)CCCN(CN2C(=O)/C(=C/c3c[nH]c4ccccc34)c3ccccc32)C1 |
| InChI | InChI=1S/C25H27N3O/c1-25(2)12-7-13-27(16-25)17-28-23-11-6-4-9-20(23)21(24(28)29)14-18-15-26-22-10-5-3-8-19(18)22/h3-6,8-11,14-15,26H,7,12-13,16-17H2,1-2H3/b21-14+ |
| InChIKey | JSOJPUQOODILBM-KGENOOAVSA-N |
| XLogP | 5.13 |
| TPSA | 39.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'ene_five_het_L(4)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (3E)-1-[(3,3-dimethylpiperidin-1-yl)methyl]-3-(1H-indol-3-ylmethylidene)indol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E)-1-[(3,3-dimethylpiperidin-1-yl)methyl]-3-(1H-indol-3-ylmethylidene)indol-2-one?
The IUPAC name of (3E)-1-[(3,3-dimethylpiperidin-1-yl)methyl]-3-(1H-indol-3-ylmethylidene)indol-2-one (CID 11978232) is (3E)-1-[(3,3-dimethylpiperidin-1-yl)methyl]-3-(1H-indol-3-ylmethylidene)indol-2-one.
What is the SMILES notation for (3E)-1-[(3,3-dimethylpiperidin-1-yl)methyl]-3-(1H-indol-3-ylmethylidene)indol-2-one?
The canonical SMILES for (3E)-1-[(3,3-dimethylpiperidin-1-yl)methyl]-3-(1H-indol-3-ylmethylidene)indol-2-one is CC1(C)CCCN(CN2C(=O)/C(=C/c3c[nH]c4ccccc34)c3ccccc32)C1.
What is the InChIKey of (3E)-1-[(3,3-dimethylpiperidin-1-yl)methyl]-3-(1H-indol-3-ylmethylidene)indol-2-one?
The InChIKey is JSOJPUQOODILBM-KGENOOAVSA-N. The full InChI is InChI=1S/C25H27N3O/c1-25(2)12-7-13-27(16-25)17-28-23-11-6-4-9-20(23)21(24(28)29)14-18-15-26-22-10-5-3-8-19(18)22/h3-6,8-11,14-15,26H,7,12-13,16-17H2,1-2H3/b21-14+.
What are the key properties of (3E)-1-[(3,3-dimethylpiperidin-1-yl)methyl]-3-(1H-indol-3-ylmethylidene)indol-2-one?
(3E)-1-[(3,3-dimethylpiperidin-1-yl)methyl]-3-(1H-indol-3-ylmethylidene)indol-2-one has a molecular weight of 385.51 g/mol, XLogP of 5.13, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3E)-1-[(3,3-dimethylpiperidin-1-yl)methyl]-3-(1H-indol-3-ylmethylidene)indol-2-one is sourced from PubChem (CID 11978232), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).