C16H23F2N3O3S — CID 119782506
3-amino-N-[5-(difluoromethylsulfonyl)-2-(ethylamino)phenyl]cyclohexane-1-carboxamide (PubChem CID 119782506) has the molecular formula C16H23F2N3O3S and a molecular weight of 375.44 g/mol. Its IUPAC name is 3-amino-N-[5-(difluoromethylsulfonyl)-2-(ethylamino)phenyl]cyclohexane-1-carboxamide.
| Compound Name | 3-amino-N-[5-(difluoromethylsulfonyl)-2-(ethylamino)phenyl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 119782506 |
| Molecular Formula | C16H23F2N3O3S |
| Molecular Weight | 375.44 g/mol |
| Exact Mass | 375.14 |
| IUPAC Name | 3-amino-N-[5-(difluoromethylsulfonyl)-2-(ethylamino)phenyl]cyclohexane-1-carboxamide |
| SMILES | CCNc1ccc(S(=O)(=O)C(F)F)cc1NC(=O)C1CCCC(N)C1 |
| InChI | InChI=1S/C16H23F2N3O3S/c1-2-20-13-7-6-12(25(23,24)16(17)18)9-14(13)21-15(22)10-4-3-5-11(19)8-10/h6-7,9-11,16,20H,2-5,8,19H2,1H3,(H,21,22) |
| InChIKey | MKNHLEMWUBAJBM-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.44 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |