C15H21Cl2N3O2 — CID 119783358
3-amino-N-[1-(2-chlorophenyl)-2-oxopyrrolidin-3-yl]-N-methylbutanamide;hydrochloride (PubChem CID 119783358) has the molecular formula C15H21Cl2N3O2 and a molecular weight of 346.26 g/mol. Its IUPAC name is 3-amino-N-[1-(2-chlorophenyl)-2-oxopyrrolidin-3-yl]-N-methylbutanamide;hydrochloride.
| Compound Name | 3-amino-N-[1-(2-chlorophenyl)-2-oxopyrrolidin-3-yl]-N-methylbutanamide;hydrochloride |
|---|---|
| PubChem CID | 119783358 |
| Molecular Formula | C15H21Cl2N3O2 |
| Molecular Weight | 346.26 g/mol |
| Exact Mass | 345.10 |
| IUPAC Name | 3-amino-N-[1-(2-chlorophenyl)-2-oxopyrrolidin-3-yl]-N-methylbutanamide;hydrochloride |
| SMILES | CC(N)CC(=O)N(C)C1CCN(c2ccccc2Cl)C1=O.Cl |
| InChI | InChI=1S/C15H20ClN3O2.ClH/c1-10(17)9-14(20)18(2)13-7-8-19(15(13)21)12-6-4-3-5-11(12)16;/h3-6,10,13H,7-9,17H2,1-2H3;1H |
| InChIKey | DKGYTBNYBNKJOR-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.26 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |