C11H19ClF3N3O2 — CID 119784798
4-(methylamino)-N-[2-oxo-1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]butanamide;hydrochloride (PubChem CID 119784798) has the molecular formula C11H19ClF3N3O2 and a molecular weight of 317.74 g/mol. Its IUPAC name is 4-(methylamino)-N-[2-oxo-1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]butanamide;hydrochloride.
| Compound Name | 4-(methylamino)-N-[2-oxo-1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]butanamide;hydrochloride |
|---|---|
| PubChem CID | 119784798 |
| Molecular Formula | C11H19ClF3N3O2 |
| Molecular Weight | 317.74 g/mol |
| Exact Mass | 317.11 |
| IUPAC Name | 4-(methylamino)-N-[2-oxo-1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]butanamide;hydrochloride |
| SMILES | CNCCCC(=O)NC1CCN(CC(F)(F)F)C1=O.Cl |
| InChI | InChI=1S/C11H18F3N3O2.ClH/c1-15-5-2-3-9(18)16-8-4-6-17(10(8)19)7-11(12,13)14;/h8,15H,2-7H2,1H3,(H,16,18);1H |
| InChIKey | UIYNYMGLBASYQA-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.74 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|