C16H31ClN2O3S — CID 119785653
N-cyclopropyl-N-(1-methylsulfonylpropan-2-yl)-3-piperidin-4-ylbutanamide;hydrochloride (PubChem CID 119785653) has the molecular formula C16H31ClN2O3S and a molecular weight of 366.96 g/mol. Its IUPAC name is N-cyclopropyl-N-(1-methylsulfonylpropan-2-yl)-3-piperidin-4-ylbutanamide;hydrochloride.
| Compound Name | N-cyclopropyl-N-(1-methylsulfonylpropan-2-yl)-3-piperidin-4-ylbutanamide;hydrochloride |
|---|---|
| PubChem CID | 119785653 |
| Molecular Formula | C16H31ClN2O3S |
| Molecular Weight | 366.96 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | N-cyclopropyl-N-(1-methylsulfonylpropan-2-yl)-3-piperidin-4-ylbutanamide;hydrochloride |
| SMILES | CC(CC(=O)N(C(C)CS(C)(=O)=O)C1CC1)C1CCNCC1.Cl |
| InChI | InChI=1S/C16H30N2O3S.ClH/c1-12(14-6-8-17-9-7-14)10-16(19)18(15-4-5-15)13(2)11-22(3,20)21;/h12-15,17H,4-11H2,1-3H3;1H |
| InChIKey | RJKAHTARVBXLMP-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.96 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |