About (2S)-2-amino-3,3-dimethyl-N-(2-oxo-1-propan-2-ylpyrrolidin-3-yl)butanamide
(2S)-2-amino-3,3-dimethyl-N-(2-oxo-1-propan-2-ylpyrrolidin-3-yl)butanamide (PubChem CID 119785943) has the molecular formula C13H25N3O2
and a molecular weight of 255.36 g/mol. Its IUPAC name is (2S)-2-amino-3,3-dimethyl-N-(2-oxo-1-propan-2-ylpyrrolidin-3-yl)butanamide.
Molecular Properties
| Compound Name | (2S)-2-amino-3,3-dimethyl-N-(2-oxo-1-propan-2-ylpyrrolidin-3-yl)butanamide |
| PubChem CID | 119785943 |
| Molecular Formula | C13H25N3O2 |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.19 |
| IUPAC Name | (2S)-2-amino-3,3-dimethyl-N-(2-oxo-1-propan-2-ylpyrrolidin-3-yl)butanamide |
| SMILES | CC(C)N1CCC(NC(=O)[C@@H](N)C(C)(C)C)C1=O |
| InChI | InChI=1S/C13H25N3O2/c1-8(2)16-7-6-9(12(16)18)15-11(17)10(14)13(3,4)5/h8-10H,6-7,14H2,1-5H3,(H,15,17)/t9?,10-/m1/s1 |
| InChIKey | XCVVENXZCXUSDO-QVDQXJPCSA-N |
| XLogP | 0.49 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2S)-2-amino-3,3-dimethyl-N-(2-oxo-1-propan-2-ylpyrrolidin-3-yl)butanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-amino-3,3-dimethyl-N-(2-oxo-1-propan-2-ylpyrrolidin-3-yl)butanamide?
The IUPAC name of (2S)-2-amino-3,3-dimethyl-N-(2-oxo-1-propan-2-ylpyrrolidin-3-yl)butanamide (CID 119785943) is (2S)-2-amino-3,3-dimethyl-N-(2-oxo-1-propan-2-ylpyrrolidin-3-yl)butanamide.
What is the SMILES notation for (2S)-2-amino-3,3-dimethyl-N-(2-oxo-1-propan-2-ylpyrrolidin-3-yl)butanamide?
The canonical SMILES for (2S)-2-amino-3,3-dimethyl-N-(2-oxo-1-propan-2-ylpyrrolidin-3-yl)butanamide is CC(C)N1CCC(NC(=O)[C@@H](N)C(C)(C)C)C1=O.
What is the InChIKey of (2S)-2-amino-3,3-dimethyl-N-(2-oxo-1-propan-2-ylpyrrolidin-3-yl)butanamide?
The InChIKey is XCVVENXZCXUSDO-QVDQXJPCSA-N. The full InChI is InChI=1S/C13H25N3O2/c1-8(2)16-7-6-9(12(16)18)15-11(17)10(14)13(3,4)5/h8-10H,6-7,14H2,1-5H3,(H,15,17)/t9?,10-/m1/s1.
What are the key properties of (2S)-2-amino-3,3-dimethyl-N-(2-oxo-1-propan-2-ylpyrrolidin-3-yl)butanamide?
(2S)-2-amino-3,3-dimethyl-N-(2-oxo-1-propan-2-ylpyrrolidin-3-yl)butanamide has a molecular weight of 255.36 g/mol, XLogP of 0.49, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-amino-3,3-dimethyl-N-(2-oxo-1-propan-2-ylpyrrolidin-3-yl)butanamide is sourced from PubChem (CID 119785943), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).