C18H33ClN2O — CID 119787865
2-(8-azabicyclo[3.2.1]octan-3-yl)-1-(4-propan-2-ylazepan-1-yl)ethanone;hydrochloride (PubChem CID 119787865) has the molecular formula C18H33ClN2O and a molecular weight of 328.93 g/mol. Its IUPAC name is 2-(8-azabicyclo[3.2.1]octan-3-yl)-1-(4-propan-2-ylazepan-1-yl)ethanone;hydrochloride.
| Compound Name | 2-(8-azabicyclo[3.2.1]octan-3-yl)-1-(4-propan-2-ylazepan-1-yl)ethanone;hydrochloride |
|---|---|
| PubChem CID | 119787865 |
| Molecular Formula | C18H33ClN2O |
| Molecular Weight | 328.93 g/mol |
| Exact Mass | 328.23 |
| IUPAC Name | 2-(8-azabicyclo[3.2.1]octan-3-yl)-1-(4-propan-2-ylazepan-1-yl)ethanone;hydrochloride |
| SMILES | CC(C)C1CCCN(C(=O)CC2CC3CCC(C2)N3)CC1.Cl |
| InChI | InChI=1S/C18H32N2O.ClH/c1-13(2)15-4-3-8-20(9-7-15)18(21)12-14-10-16-5-6-17(11-14)19-16;/h13-17,19H,3-12H2,1-2H3;1H |
| InChIKey | FPAWGLNVZLXJJE-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.93 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |