C10H15ClN2O2S — CID 119788958
2-morpholin-2-yl-N-thiophen-3-ylacetamide;hydrochloride (PubChem CID 119788958) has the molecular formula C10H15ClN2O2S and a molecular weight of 262.76 g/mol. Its IUPAC name is 2-morpholin-2-yl-N-thiophen-3-ylacetamide;hydrochloride.
| Compound Name | 2-morpholin-2-yl-N-thiophen-3-ylacetamide;hydrochloride |
|---|---|
| PubChem CID | 119788958 |
| Molecular Formula | C10H15ClN2O2S |
| Molecular Weight | 262.76 g/mol |
| Exact Mass | 262.05 |
| IUPAC Name | 2-morpholin-2-yl-N-thiophen-3-ylacetamide;hydrochloride |
| SMILES | Cl.O=C(CC1CNCCO1)Nc1ccsc1 |
| InChI | InChI=1S/C10H14N2O2S.ClH/c13-10(12-8-1-4-15-7-8)5-9-6-11-2-3-14-9;/h1,4,7,9,11H,2-3,5-6H2,(H,12,13);1H |
| InChIKey | FOSVBVUDNYKCRI-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.76 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |