About 2-amino-1-(2,2-dimethylthiomorpholin-4-yl)-2-methylpentan-1-one;hydrochloride
2-amino-1-(2,2-dimethylthiomorpholin-4-yl)-2-methylpentan-1-one;hydrochloride (PubChem CID 119791877) has the molecular formula C12H25ClN2OS
and a molecular weight of 280.87 g/mol. Its IUPAC name is 2-amino-1-(2,2-dimethylthiomorpholin-4-yl)-2-methylpentan-1-one;hydrochloride.
Molecular Properties
| Compound Name | 2-amino-1-(2,2-dimethylthiomorpholin-4-yl)-2-methylpentan-1-one;hydrochloride |
| PubChem CID | 119791877 |
| Molecular Formula | C12H25ClN2OS |
| Molecular Weight | 280.87 g/mol |
| Exact Mass | 280.14 |
| IUPAC Name | 2-amino-1-(2,2-dimethylthiomorpholin-4-yl)-2-methylpentan-1-one;hydrochloride |
| SMILES | CCCC(C)(N)C(=O)N1CCSC(C)(C)C1.Cl |
| InChI | InChI=1S/C12H24N2OS.ClH/c1-5-6-12(4,13)10(15)14-7-8-16-11(2,3)9-14;/h5-9,13H2,1-4H3;1H |
| InChIKey | YFBCRXTZIJCAGK-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.87 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-amino-1-(2,2-dimethylthiomorpholin-4-yl)-2-methylpentan-1-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-1-(2,2-dimethylthiomorpholin-4-yl)-2-methylpentan-1-one;hydrochloride?
The IUPAC name of 2-amino-1-(2,2-dimethylthiomorpholin-4-yl)-2-methylpentan-1-one;hydrochloride (CID 119791877) is 2-amino-1-(2,2-dimethylthiomorpholin-4-yl)-2-methylpentan-1-one;hydrochloride.
What is the SMILES notation for 2-amino-1-(2,2-dimethylthiomorpholin-4-yl)-2-methylpentan-1-one;hydrochloride?
The canonical SMILES for 2-amino-1-(2,2-dimethylthiomorpholin-4-yl)-2-methylpentan-1-one;hydrochloride is CCCC(C)(N)C(=O)N1CCSC(C)(C)C1.Cl.
What is the InChIKey of 2-amino-1-(2,2-dimethylthiomorpholin-4-yl)-2-methylpentan-1-one;hydrochloride?
The InChIKey is YFBCRXTZIJCAGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24N2OS.ClH/c1-5-6-12(4,13)10(15)14-7-8-16-11(2,3)9-14;/h5-9,13H2,1-4H3;1H.
What are the key properties of 2-amino-1-(2,2-dimethylthiomorpholin-4-yl)-2-methylpentan-1-one;hydrochloride?
2-amino-1-(2,2-dimethylthiomorpholin-4-yl)-2-methylpentan-1-one;hydrochloride has a molecular weight of 280.87 g/mol, XLogP of 2.28, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-1-(2,2-dimethylthiomorpholin-4-yl)-2-methylpentan-1-one;hydrochloride is sourced from PubChem (CID 119791877), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).