About 2-amino-N,2-dimethyl-N-(2-oxo-1-phenylpiperidin-3-yl)pentanamide;hydrochloride
2-amino-N,2-dimethyl-N-(2-oxo-1-phenylpiperidin-3-yl)pentanamide;hydrochloride (PubChem CID 119792252) has the molecular formula C18H28ClN3O2
and a molecular weight of 353.89 g/mol. Its IUPAC name is 2-amino-N,2-dimethyl-N-(2-oxo-1-phenylpiperidin-3-yl)pentanamide;hydrochloride.
Molecular Properties
| Compound Name | 2-amino-N,2-dimethyl-N-(2-oxo-1-phenylpiperidin-3-yl)pentanamide;hydrochloride |
| PubChem CID | 119792252 |
| Molecular Formula | C18H28ClN3O2 |
| Molecular Weight | 353.89 g/mol |
| Exact Mass | 353.19 |
| IUPAC Name | 2-amino-N,2-dimethyl-N-(2-oxo-1-phenylpiperidin-3-yl)pentanamide;hydrochloride |
| SMILES | CCCC(C)(N)C(=O)N(C)C1CCCN(c2ccccc2)C1=O.Cl |
| InChI | InChI=1S/C18H27N3O2.ClH/c1-4-12-18(2,19)17(23)20(3)15-11-8-13-21(16(15)22)14-9-6-5-7-10-14;/h5-7,9-10,15H,4,8,11-13,19H2,1-3H3;1H |
| InChIKey | RFOBJZGLZLFACG-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.89 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-amino-N,2-dimethyl-N-(2-oxo-1-phenylpiperidin-3-yl)pentanamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-N,2-dimethyl-N-(2-oxo-1-phenylpiperidin-3-yl)pentanamide;hydrochloride?
The IUPAC name of 2-amino-N,2-dimethyl-N-(2-oxo-1-phenylpiperidin-3-yl)pentanamide;hydrochloride (CID 119792252) is 2-amino-N,2-dimethyl-N-(2-oxo-1-phenylpiperidin-3-yl)pentanamide;hydrochloride.
What is the SMILES notation for 2-amino-N,2-dimethyl-N-(2-oxo-1-phenylpiperidin-3-yl)pentanamide;hydrochloride?
The canonical SMILES for 2-amino-N,2-dimethyl-N-(2-oxo-1-phenylpiperidin-3-yl)pentanamide;hydrochloride is CCCC(C)(N)C(=O)N(C)C1CCCN(c2ccccc2)C1=O.Cl.
What is the InChIKey of 2-amino-N,2-dimethyl-N-(2-oxo-1-phenylpiperidin-3-yl)pentanamide;hydrochloride?
The InChIKey is RFOBJZGLZLFACG-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H27N3O2.ClH/c1-4-12-18(2,19)17(23)20(3)15-11-8-13-21(16(15)22)14-9-6-5-7-10-14;/h5-7,9-10,15H,4,8,11-13,19H2,1-3H3;1H.
What are the key properties of 2-amino-N,2-dimethyl-N-(2-oxo-1-phenylpiperidin-3-yl)pentanamide;hydrochloride?
2-amino-N,2-dimethyl-N-(2-oxo-1-phenylpiperidin-3-yl)pentanamide;hydrochloride has a molecular weight of 353.89 g/mol, XLogP of 2.58, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-N,2-dimethyl-N-(2-oxo-1-phenylpiperidin-3-yl)pentanamide;hydrochloride is sourced from PubChem (CID 119792252), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).