About 2,2-dimethyl-1-oxido-1,3-dihydropyrrol-1-ium
2,2-dimethyl-1-oxido-1,3-dihydropyrrol-1-ium (PubChem CID 11979254) has the molecular formula C6H11NO
and a molecular weight of 113.16 g/mol. Its IUPAC name is 2,2-dimethyl-1-oxido-1,3-dihydropyrrol-1-ium.
Molecular Properties
| Compound Name | 2,2-dimethyl-1-oxido-1,3-dihydropyrrol-1-ium |
| PubChem CID | 11979254 |
| Molecular Formula | C6H11NO |
| Molecular Weight | 113.16 g/mol |
| Exact Mass | 113.08 |
| IUPAC Name | 2,2-dimethyl-1-oxido-1,3-dihydropyrrol-1-ium |
| SMILES | CC1(C)CC=C[NH+]1[O-] |
| InChI | InChI=1S/C6H11NO/c1-6(2)4-3-5-7(6)8/h3,5,7H,4H2,1-2H3 |
| InChIKey | CCYDPAYWQMZWMB-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 27.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 113.16 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,2-dimethyl-1-oxido-1,3-dihydropyrrol-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethyl-1-oxido-1,3-dihydropyrrol-1-ium?
The IUPAC name of 2,2-dimethyl-1-oxido-1,3-dihydropyrrol-1-ium (CID 11979254) is 2,2-dimethyl-1-oxido-1,3-dihydropyrrol-1-ium.
What is the SMILES notation for 2,2-dimethyl-1-oxido-1,3-dihydropyrrol-1-ium?
The canonical SMILES for 2,2-dimethyl-1-oxido-1,3-dihydropyrrol-1-ium is CC1(C)CC=C[NH+]1[O-].
What is the InChIKey of 2,2-dimethyl-1-oxido-1,3-dihydropyrrol-1-ium?
The InChIKey is CCYDPAYWQMZWMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NO/c1-6(2)4-3-5-7(6)8/h3,5,7H,4H2,1-2H3.
What are the key properties of 2,2-dimethyl-1-oxido-1,3-dihydropyrrol-1-ium?
2,2-dimethyl-1-oxido-1,3-dihydropyrrol-1-ium has a molecular weight of 113.16 g/mol, XLogP of 0.07, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethyl-1-oxido-1,3-dihydropyrrol-1-ium is sourced from PubChem (CID 11979254), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).