C18H29ClN2O — CID 11979286
N'-(1-benzofuran-2-ylmethyl)-N'-ethyl-N,N-dimethylpentane-1,5-diamine;hydrochloride (PubChem CID 11979286) has the molecular formula C18H29ClN2O and a molecular weight of 324.90 g/mol. Its IUPAC name is N'-(1-benzofuran-2-ylmethyl)-N'-ethyl-N,N-dimethylpentane-1,5-diamine;hydrochloride.
| Compound Name | N'-(1-benzofuran-2-ylmethyl)-N'-ethyl-N,N-dimethylpentane-1,5-diamine;hydrochloride |
|---|---|
| PubChem CID | 11979286 |
| Molecular Formula | C18H29ClN2O |
| Molecular Weight | 324.90 g/mol |
| Exact Mass | 324.20 |
| IUPAC Name | N'-(1-benzofuran-2-ylmethyl)-N'-ethyl-N,N-dimethylpentane-1,5-diamine;hydrochloride |
| SMILES | CCN(CCCCCN(C)C)Cc1cc2ccccc2o1.Cl |
| InChI | InChI=1S/C18H28N2O.ClH/c1-4-20(13-9-5-8-12-19(2)3)15-17-14-16-10-6-7-11-18(16)21-17;/h6-7,10-11,14H,4-5,8-9,12-13,15H2,1-3H3;1H |
| InChIKey | AQWHZAPKPWTJQK-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 19.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.90 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|