C18H27ClN2O3 — CID 119793780
2-(cyclopropylmethylamino)-N-[4-(2-hydroxycyclohexyl)oxyphenyl]acetamide;hydrochloride (PubChem CID 119793780) has the molecular formula C18H27ClN2O3 and a molecular weight of 354.88 g/mol. Its IUPAC name is 2-(cyclopropylmethylamino)-N-[4-(2-hydroxycyclohexyl)oxyphenyl]acetamide;hydrochloride.
| Compound Name | 2-(cyclopropylmethylamino)-N-[4-(2-hydroxycyclohexyl)oxyphenyl]acetamide;hydrochloride |
|---|---|
| PubChem CID | 119793780 |
| Molecular Formula | C18H27ClN2O3 |
| Molecular Weight | 354.88 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | 2-(cyclopropylmethylamino)-N-[4-(2-hydroxycyclohexyl)oxyphenyl]acetamide;hydrochloride |
| SMILES | Cl.O=C(CNCC1CC1)Nc1ccc(OC2CCCCC2O)cc1 |
| InChI | InChI=1S/C18H26N2O3.ClH/c21-16-3-1-2-4-17(16)23-15-9-7-14(8-10-15)20-18(22)12-19-11-13-5-6-13;/h7-10,13,16-17,19,21H,1-6,11-12H2,(H,20,22);1H |
| InChIKey | MIPQTLAVTMHORE-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.88 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |