C21H26N2O2 — CID 119794511
3-amino-N-[4-(phenylmethoxymethyl)phenyl]cyclohexane-1-carboxamide (PubChem CID 119794511) has the molecular formula C21H26N2O2 and a molecular weight of 338.45 g/mol. Its IUPAC name is 3-amino-N-[4-(phenylmethoxymethyl)phenyl]cyclohexane-1-carboxamide.
| Compound Name | 3-amino-N-[4-(phenylmethoxymethyl)phenyl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 119794511 |
| Molecular Formula | C21H26N2O2 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.20 |
| IUPAC Name | 3-amino-N-[4-(phenylmethoxymethyl)phenyl]cyclohexane-1-carboxamide |
| SMILES | NC1CCCC(C(=O)Nc2ccc(COCc3ccccc3)cc2)C1 |
| InChI | InChI=1S/C21H26N2O2/c22-19-8-4-7-18(13-19)21(24)23-20-11-9-17(10-12-20)15-25-14-16-5-2-1-3-6-16/h1-3,5-6,9-12,18-19H,4,7-8,13-15,22H2,(H,23,24) |
| InChIKey | BCALJIVRWNHPST-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |