C15H21F3N2OS — CID 119795100
7-amino-N-[2-(2,2-difluoroethylsulfanyl)-5-fluorophenyl]heptanamide (PubChem CID 119795100) has the molecular formula C15H21F3N2OS and a molecular weight of 334.41 g/mol. Its IUPAC name is 7-amino-N-[2-(2,2-difluoroethylsulfanyl)-5-fluorophenyl]heptanamide.
| Compound Name | 7-amino-N-[2-(2,2-difluoroethylsulfanyl)-5-fluorophenyl]heptanamide |
|---|---|
| PubChem CID | 119795100 |
| Molecular Formula | C15H21F3N2OS |
| Molecular Weight | 334.41 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | 7-amino-N-[2-(2,2-difluoroethylsulfanyl)-5-fluorophenyl]heptanamide |
| SMILES | NCCCCCCC(=O)Nc1cc(F)ccc1SCC(F)F |
| InChI | InChI=1S/C15H21F3N2OS/c16-11-6-7-13(22-10-14(17)18)12(9-11)20-15(21)5-3-1-2-4-8-19/h6-7,9,14H,1-5,8,10,19H2,(H,20,21) |
| InChIKey | DGIFKQDCXSMCCJ-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.41 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|