About bis(cyclopenta-2,4-dien-1-yl(diphenyl)phosphane);iron
bis(cyclopenta-2,4-dien-1-yl(diphenyl)phosphane);iron (PubChem CID 11979534) has the molecular formula C34H20FeP2-10
and a molecular weight of 546.33 g/mol. Its IUPAC name is bis(cyclopenta-2,4-dien-1-yl(diphenyl)phosphane);iron.
Molecular Properties
| Compound Name | bis(cyclopenta-2,4-dien-1-yl(diphenyl)phosphane);iron |
| PubChem CID | 11979534 |
| Molecular Formula | C34H20FeP2-10 |
| Molecular Weight | 546.33 g/mol |
| Exact Mass | 546.04 |
| IUPAC Name | bis(cyclopenta-2,4-dien-1-yl(diphenyl)phosphane);iron |
| SMILES | [Fe].[c-]1[c-][c-][c-](P(c2ccccc2)c2ccccc2)[c-]1.[c-]1[c-][c-][c-](P(c2ccccc2)c2ccccc2)[c-]1 |
| InChI | InChI=1S/2C17H10P.Fe/c2*1-3-9-15(10-4-1)18(17-13-7-8-14-17)16-11-5-2-6-12-16;/h2*1-6,9-12H;/q2*-5; |
| InChIKey | KNVAAITVNCIMBM-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 546.33 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze bis(cyclopenta-2,4-dien-1-yl(diphenyl)phosphane);iron with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(cyclopenta-2,4-dien-1-yl(diphenyl)phosphane);iron?
The IUPAC name of bis(cyclopenta-2,4-dien-1-yl(diphenyl)phosphane);iron (CID 11979534) is bis(cyclopenta-2,4-dien-1-yl(diphenyl)phosphane);iron.
What is the SMILES notation for bis(cyclopenta-2,4-dien-1-yl(diphenyl)phosphane);iron?
The canonical SMILES for bis(cyclopenta-2,4-dien-1-yl(diphenyl)phosphane);iron is [Fe].[c-]1[c-][c-][c-](P(c2ccccc2)c2ccccc2)[c-]1.[c-]1[c-][c-][c-](P(c2ccccc2)c2ccccc2)[c-]1.
What is the InChIKey of bis(cyclopenta-2,4-dien-1-yl(diphenyl)phosphane);iron?
The InChIKey is KNVAAITVNCIMBM-UHFFFAOYSA-N. The full InChI is InChI=1S/2C17H10P.Fe/c2*1-3-9-15(10-4-1)18(17-13-7-8-14-17)16-11-5-2-6-12-16;/h2*1-6,9-12H;/q2*-5;.
What are the key properties of bis(cyclopenta-2,4-dien-1-yl(diphenyl)phosphane);iron?
bis(cyclopenta-2,4-dien-1-yl(diphenyl)phosphane);iron has a molecular weight of 546.33 g/mol, XLogP of 4.73, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for bis(cyclopenta-2,4-dien-1-yl(diphenyl)phosphane);iron is sourced from PubChem (CID 11979534), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).