C13H29ClN2O — CID 119796493
7-amino-N-(2,3-dimethylbutyl)heptanamide;hydrochloride (PubChem CID 119796493) has the molecular formula C13H29ClN2O and a molecular weight of 264.84 g/mol. Its IUPAC name is 7-amino-N-(2,3-dimethylbutyl)heptanamide;hydrochloride.
| Compound Name | 7-amino-N-(2,3-dimethylbutyl)heptanamide;hydrochloride |
|---|---|
| PubChem CID | 119796493 |
| Molecular Formula | C13H29ClN2O |
| Molecular Weight | 264.84 g/mol |
| Exact Mass | 264.20 |
| IUPAC Name | 7-amino-N-(2,3-dimethylbutyl)heptanamide;hydrochloride |
| SMILES | CC(C)C(C)CNC(=O)CCCCCCN.Cl |
| InChI | InChI=1S/C13H28N2O.ClH/c1-11(2)12(3)10-15-13(16)8-6-4-5-7-9-14;/h11-12H,4-10,14H2,1-3H3,(H,15,16);1H |
| InChIKey | AAZJQHRMYHBTKP-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.84 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|