C16H24N4O3 — CID 119796957
3-amino-N,N-bis[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]butanamide (PubChem CID 119796957) has the molecular formula C16H24N4O3 and a molecular weight of 320.39 g/mol. Its IUPAC name is 3-amino-N,N-bis[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]butanamide.
| Compound Name | 3-amino-N,N-bis[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]butanamide |
|---|---|
| PubChem CID | 119796957 |
| Molecular Formula | C16H24N4O3 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.18 |
| IUPAC Name | 3-amino-N,N-bis[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]butanamide |
| SMILES | Cc1noc(C)c1CN(Cc1c(C)noc1C)C(=O)CC(C)N |
| InChI | InChI=1S/C16H24N4O3/c1-9(17)6-16(21)20(7-14-10(2)18-22-12(14)4)8-15-11(3)19-23-13(15)5/h9H,6-8,17H2,1-5H3 |
| InChIKey | UVMQKVGAGBHYPD-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 98.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |