C16H24ClN3O — CID 119797080
2-methyl-3-(methylamino)-N-(1-propylindol-6-yl)propanamide;hydrochloride (PubChem CID 119797080) has the molecular formula C16H24ClN3O and a molecular weight of 309.84 g/mol. Its IUPAC name is 2-methyl-3-(methylamino)-N-(1-propylindol-6-yl)propanamide;hydrochloride.
| Compound Name | 2-methyl-3-(methylamino)-N-(1-propylindol-6-yl)propanamide;hydrochloride |
|---|---|
| PubChem CID | 119797080 |
| Molecular Formula | C16H24ClN3O |
| Molecular Weight | 309.84 g/mol |
| Exact Mass | 309.16 |
| IUPAC Name | 2-methyl-3-(methylamino)-N-(1-propylindol-6-yl)propanamide;hydrochloride |
| SMILES | CCCn1ccc2ccc(NC(=O)C(C)CNC)cc21.Cl |
| InChI | InChI=1S/C16H23N3O.ClH/c1-4-8-19-9-7-13-5-6-14(10-15(13)19)18-16(20)12(2)11-17-3;/h5-7,9-10,12,17H,4,8,11H2,1-3H3,(H,18,20);1H |
| InChIKey | MFXMBHJPJYHCNT-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 46.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.84 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |