C16H23N3O3S — CID 119797391
2-(cyclopropylmethylamino)-N-[3-(cyclopropylsulfamoyl)-4-methylphenyl]acetamide (PubChem CID 119797391) has the molecular formula C16H23N3O3S and a molecular weight of 337.45 g/mol. Its IUPAC name is 2-(cyclopropylmethylamino)-N-[3-(cyclopropylsulfamoyl)-4-methylphenyl]acetamide.
| Compound Name | 2-(cyclopropylmethylamino)-N-[3-(cyclopropylsulfamoyl)-4-methylphenyl]acetamide |
|---|---|
| PubChem CID | 119797391 |
| Molecular Formula | C16H23N3O3S |
| Molecular Weight | 337.45 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | 2-(cyclopropylmethylamino)-N-[3-(cyclopropylsulfamoyl)-4-methylphenyl]acetamide |
| SMILES | Cc1ccc(NC(=O)CNCC2CC2)cc1S(=O)(=O)NC1CC1 |
| InChI | InChI=1S/C16H23N3O3S/c1-11-2-5-14(18-16(20)10-17-9-12-3-4-12)8-15(11)23(21,22)19-13-6-7-13/h2,5,8,12-13,17,19H,3-4,6-7,9-10H2,1H3,(H,18,20) |
| InChIKey | VSPXSLOQVHDWJP-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.45 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |