C15H23ClN2OS — CID 119797989
3-amino-N-(2-propan-2-ylsulfanylphenyl)cyclopentane-1-carboxamide;hydrochloride (PubChem CID 119797989) has the molecular formula C15H23ClN2OS and a molecular weight of 314.88 g/mol. Its IUPAC name is 3-amino-N-(2-propan-2-ylsulfanylphenyl)cyclopentane-1-carboxamide;hydrochloride.
| Compound Name | 3-amino-N-(2-propan-2-ylsulfanylphenyl)cyclopentane-1-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119797989 |
| Molecular Formula | C15H23ClN2OS |
| Molecular Weight | 314.88 g/mol |
| Exact Mass | 314.12 |
| IUPAC Name | 3-amino-N-(2-propan-2-ylsulfanylphenyl)cyclopentane-1-carboxamide;hydrochloride |
| SMILES | CC(C)Sc1ccccc1NC(=O)C1CCC(N)C1.Cl |
| InChI | InChI=1S/C15H22N2OS.ClH/c1-10(2)19-14-6-4-3-5-13(14)17-15(18)11-7-8-12(16)9-11;/h3-6,10-12H,7-9,16H2,1-2H3,(H,17,18);1H |
| InChIKey | AIDZROMWCIVVCS-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.88 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |