C18H27ClN2O2 — CID 119798178
3-amino-N-[1-(5-chloro-2-methoxyphenyl)-3-methylbutyl]cyclopentane-1-carboxamide (PubChem CID 119798178) has the molecular formula C18H27ClN2O2 and a molecular weight of 338.88 g/mol. Its IUPAC name is 3-amino-N-[1-(5-chloro-2-methoxyphenyl)-3-methylbutyl]cyclopentane-1-carboxamide.
| Compound Name | 3-amino-N-[1-(5-chloro-2-methoxyphenyl)-3-methylbutyl]cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 119798178 |
| Molecular Formula | C18H27ClN2O2 |
| Molecular Weight | 338.88 g/mol |
| Exact Mass | 338.18 |
| IUPAC Name | 3-amino-N-[1-(5-chloro-2-methoxyphenyl)-3-methylbutyl]cyclopentane-1-carboxamide |
| SMILES | COc1ccc(Cl)cc1C(CC(C)C)NC(=O)C1CCC(N)C1 |
| InChI | InChI=1S/C18H27ClN2O2/c1-11(2)8-16(15-10-13(19)5-7-17(15)23-3)21-18(22)12-4-6-14(20)9-12/h5,7,10-12,14,16H,4,6,8-9,20H2,1-3H3,(H,21,22) |
| InChIKey | UQSUJBIXSZIXJQ-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.88 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |