C20H25ClN2O — CID 119799547
3-amino-N-(cyclobutylmethyl)-N-(1-phenylethyl)benzamide;hydrochloride (PubChem CID 119799547) has the molecular formula C20H25ClN2O and a molecular weight of 344.89 g/mol. Its IUPAC name is 3-amino-N-(cyclobutylmethyl)-N-(1-phenylethyl)benzamide;hydrochloride.
| Compound Name | 3-amino-N-(cyclobutylmethyl)-N-(1-phenylethyl)benzamide;hydrochloride |
|---|---|
| PubChem CID | 119799547 |
| Molecular Formula | C20H25ClN2O |
| Molecular Weight | 344.89 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | 3-amino-N-(cyclobutylmethyl)-N-(1-phenylethyl)benzamide;hydrochloride |
| SMILES | CC(c1ccccc1)N(CC1CCC1)C(=O)c1cccc(N)c1.Cl |
| InChI | InChI=1S/C20H24N2O.ClH/c1-15(17-9-3-2-4-10-17)22(14-16-7-5-8-16)20(23)18-11-6-12-19(21)13-18;/h2-4,6,9-13,15-16H,5,7-8,14,21H2,1H3;1H |
| InChIKey | RIFLAXOCVXKUEN-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.89 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|