C16H8N6O10 — CID 11979970
5-[[2,4-dinitro-5-[(2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]phenyl]methylidene]-1,3-diazinane-2,4,6-trione (PubChem CID 11979970) has the molecular formula C16H8N6O10 and a molecular weight of 444.27 g/mol. Its IUPAC name is 5-[[2,4-dinitro-5-[(2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]phenyl]methylidene]-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[[2,4-dinitro-5-[(2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]phenyl]methylidene]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 11979970 |
| Molecular Formula | C16H8N6O10 |
| Molecular Weight | 444.27 g/mol |
| Exact Mass | 444.03 |
| IUPAC Name | 5-[[2,4-dinitro-5-[(2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]phenyl]methylidene]-1,3-diazinane-2,4,6-trione |
| SMILES | O=C1NC(=O)C(=Cc2cc(C=C3C(=O)NC(=O)NC3=O)c([N+](=O)[O-])cc2[N+](=O)[O-])C(=O)N1 |
| InChI | InChI=1S/C16H8N6O10/c23-11-7(12(24)18-15(27)17-11)2-5-1-6(10(22(31)32)4-9(5)21(29)30)3-8-13(25)19-16(28)20-14(8)26/h1-4H,(H2,17,18,23,24,27)(H2,19,20,25,26,28) |
| InChIKey | XLWADCHNDJCFIP-UHFFFAOYSA-N |
| XLogP | -1.00 |
| TPSA | 236.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.27 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|