C16H21BrN2O — CID 119800146
3-amino-N-[[1-(2-bromophenyl)cyclopropyl]methyl]cyclopentane-1-carboxamide (PubChem CID 119800146) has the molecular formula C16H21BrN2O and a molecular weight of 337.26 g/mol. Its IUPAC name is 3-amino-N-[[1-(2-bromophenyl)cyclopropyl]methyl]cyclopentane-1-carboxamide.
| Compound Name | 3-amino-N-[[1-(2-bromophenyl)cyclopropyl]methyl]cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 119800146 |
| Molecular Formula | C16H21BrN2O |
| Molecular Weight | 337.26 g/mol |
| Exact Mass | 336.08 |
| IUPAC Name | 3-amino-N-[[1-(2-bromophenyl)cyclopropyl]methyl]cyclopentane-1-carboxamide |
| SMILES | NC1CCC(C(=O)NCC2(c3ccccc3Br)CC2)C1 |
| InChI | InChI=1S/C16H21BrN2O/c17-14-4-2-1-3-13(14)16(7-8-16)10-19-15(20)11-5-6-12(18)9-11/h1-4,11-12H,5-10,18H2,(H,19,20) |
| InChIKey | HFXHXQZZQPGAND-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.26 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |